C6H14N2O3 — CID 59658304
2-amino-3-hydroxy-N-(2-methoxyethyl)propanamide (PubChem CID 59658304) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-amino-3-hydroxy-N-(2-methoxyethyl)propanamide.
| Compound Name | 2-amino-3-hydroxy-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 59658304 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2-amino-3-hydroxy-N-(2-methoxyethyl)propanamide |
| SMILES | COCCNC(=O)C(N)CO |
| InChI | InChI=1S/C6H14N2O3/c1-11-3-2-8-6(10)5(7)4-9/h5,9H,2-4,7H2,1H3,(H,8,10) |
| InChIKey | NIFNGEBHKASWDC-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|