C8H18N2O4 — CID 81089376
2-amino-N-[2-(2-hydroxyethoxy)ethyl]-3-methoxypropanamide (PubChem CID 81089376) has the molecular formula C8H18N2O4 and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-amino-N-[2-(2-hydroxyethoxy)ethyl]-3-methoxypropanamide.
| Compound Name | 2-amino-N-[2-(2-hydroxyethoxy)ethyl]-3-methoxypropanamide |
|---|---|
| PubChem CID | 81089376 |
| Molecular Formula | C8H18N2O4 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2-amino-N-[2-(2-hydroxyethoxy)ethyl]-3-methoxypropanamide |
| SMILES | COCC(N)C(=O)NCCOCCO |
| InChI | InChI=1S/C8H18N2O4/c1-13-6-7(9)8(12)10-2-4-14-5-3-11/h7,11H,2-6,9H2,1H3,(H,10,12) |
| InChIKey | TXOSKFRSXIGTFC-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|