C9H16N2O3 — CID 115563193
2-amino-N-[2-(2-hydroxyethoxy)ethyl]pent-4-ynamide (PubChem CID 115563193) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-amino-N-[2-(2-hydroxyethoxy)ethyl]pent-4-ynamide.
| Compound Name | 2-amino-N-[2-(2-hydroxyethoxy)ethyl]pent-4-ynamide |
|---|---|
| PubChem CID | 115563193 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2-amino-N-[2-(2-hydroxyethoxy)ethyl]pent-4-ynamide |
| SMILES | C#CCC(N)C(=O)NCCOCCO |
| InChI | InChI=1S/C9H16N2O3/c1-2-3-8(10)9(13)11-4-6-14-7-5-12/h1,8,12H,3-7,10H2,(H,11,13) |
| InChIKey | NJQTXOFDNMIBJN-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|