C9H21N3O3 — CID 89199743
(2S)-2,5-diamino-N-[2-(2-hydroxyethoxy)ethyl]pentanamide (PubChem CID 89199743) has the molecular formula C9H21N3O3 and a molecular weight of 219.28 g/mol. Its IUPAC name is (2S)-2,5-diamino-N-[2-(2-hydroxyethoxy)ethyl]pentanamide.
| Compound Name | (2S)-2,5-diamino-N-[2-(2-hydroxyethoxy)ethyl]pentanamide |
|---|---|
| PubChem CID | 89199743 |
| Molecular Formula | C9H21N3O3 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (2S)-2,5-diamino-N-[2-(2-hydroxyethoxy)ethyl]pentanamide |
| SMILES | NCCC[C@H](N)C(=O)NCCOCCO |
| InChI | InChI=1S/C9H21N3O3/c10-3-1-2-8(11)9(14)12-4-6-15-7-5-13/h8,13H,1-7,10-11H2,(H,12,14)/t8-/m0/s1 |
| InChIKey | MKSRNRYMPIJMHE-QMMMGPOBSA-N |
| XLogP | -1.82 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|