C13H29N3O3 — CID 58954613
(2S)-2,6-diamino-N-[2-(2-propoxyethoxy)ethyl]hexanamide (PubChem CID 58954613) has the molecular formula C13H29N3O3 and a molecular weight of 275.39 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-(2-propoxyethoxy)ethyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[2-(2-propoxyethoxy)ethyl]hexanamide |
|---|---|
| PubChem CID | 58954613 |
| Molecular Formula | C13H29N3O3 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-(2-propoxyethoxy)ethyl]hexanamide |
| SMILES | CCCOCCOCCNC(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C13H29N3O3/c1-2-8-18-10-11-19-9-7-16-13(17)12(15)5-3-4-6-14/h12H,2-11,14-15H2,1H3,(H,16,17)/t12-/m0/s1 |
| InChIKey | ZRIWQRUBWMDVFT-LBPRGKRZSA-N |
| XLogP | 0.00 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|