C20H35N3O5 — CID 139468187
(2S)-2,6-diamino-N-[2-[2-[(2R)-2-hydroxy-3-phenylmethoxypropoxy]ethoxy]ethyl]hexanamide (PubChem CID 139468187) has the molecular formula C20H35N3O5 and a molecular weight of 397.52 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[2-[2-[(2R)-2-hydroxy-3-phenylmethoxypropoxy]ethoxy]ethyl]hexanamide.
| Compound Name | (2S)-2,6-diamino-N-[2-[2-[(2R)-2-hydroxy-3-phenylmethoxypropoxy]ethoxy]ethyl]hexanamide |
|---|---|
| PubChem CID | 139468187 |
| Molecular Formula | C20H35N3O5 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | (2S)-2,6-diamino-N-[2-[2-[(2R)-2-hydroxy-3-phenylmethoxypropoxy]ethoxy]ethyl]hexanamide |
| SMILES | NCCCC[C@H](N)C(=O)NCCOCCOC[C@H](O)COCc1ccccc1 |
| InChI | InChI=1S/C20H35N3O5/c21-9-5-4-8-19(22)20(25)23-10-11-26-12-13-27-15-18(24)16-28-14-17-6-2-1-3-7-17/h1-3,6-7,18-19,24H,4-5,8-16,21-22H2,(H,23,25)/t18-,19-/m0/s1 |
| InChIKey | FKVRRAWHKCZUAG-OALUTQOASA-N |
| XLogP | 0.17 |
| TPSA | 129.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|