C19H35N3O5 — CID 145152386
2-amino-6-phenylmethoxyhexanoic acid;2,4-diaminobutanoic acid;ethane (PubChem CID 145152386) has the molecular formula C19H35N3O5 and a molecular weight of 385.51 g/mol. Its IUPAC name is 2-amino-6-phenylmethoxyhexanoic acid;2,4-diaminobutanoic acid;ethane.
| Compound Name | 2-amino-6-phenylmethoxyhexanoic acid;2,4-diaminobutanoic acid;ethane |
|---|---|
| PubChem CID | 145152386 |
| Molecular Formula | C19H35N3O5 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 2-amino-6-phenylmethoxyhexanoic acid;2,4-diaminobutanoic acid;ethane |
| SMILES | CC.NC(CCCCOCc1ccccc1)C(=O)O.NCCC(N)C(=O)O |
| InChI | InChI=1S/C13H19NO3.C4H10N2O2.C2H6/c14-12(13(15)16)8-4-5-9-17-10-11-6-2-1-3-7-11;5-2-1-3(6)4(7)8;1-2/h1-3,6-7,12H,4-5,8-10,14H2,(H,15,16);3H,1-2,5-6H2,(H,7,8);1-2H3 |
| InChIKey | MTOPNDWPAFBBCP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 161.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|