C14H20N2O4 — CID 70487944
(6S)-2,6-diamino-7-oxo-7-phenylmethoxyheptanoic acid (PubChem CID 70487944) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is (6S)-2,6-diamino-7-oxo-7-phenylmethoxyheptanoic acid.
| Compound Name | (6S)-2,6-diamino-7-oxo-7-phenylmethoxyheptanoic acid |
|---|---|
| PubChem CID | 70487944 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | (6S)-2,6-diamino-7-oxo-7-phenylmethoxyheptanoic acid |
| SMILES | NC(CCC[C@H](N)C(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H20N2O4/c15-11(13(17)18)7-4-8-12(16)14(19)20-9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9,15-16H2,(H,17,18)/t11?,12-/m0/s1 |
| InChIKey | JVEUTCWLEJSEDI-KIYNQFGBSA-N |
| XLogP | 0.64 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |