C15H21N3O5 — CID 11493537
2,7-diamino-7-oxo-6-(phenylmethoxycarbonylamino)heptanoic acid (PubChem CID 11493537) has the molecular formula C15H21N3O5 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2,7-diamino-7-oxo-6-(phenylmethoxycarbonylamino)heptanoic acid.
| Compound Name | 2,7-diamino-7-oxo-6-(phenylmethoxycarbonylamino)heptanoic acid |
|---|---|
| PubChem CID | 11493537 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2,7-diamino-7-oxo-6-(phenylmethoxycarbonylamino)heptanoic acid |
| SMILES | NC(=O)C(CCCC(N)C(=O)O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H21N3O5/c16-11(14(20)21)7-4-8-12(13(17)19)18-15(22)23-9-10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9,16H2,(H2,17,19)(H,18,22)(H,20,21) |
| InChIKey | IABICGSOMUDOEP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 144.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |