C23H29ClN2O6 — CID 69169633
7-O-benzyl 1-O-methyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)heptanedioate;hydrochloride (PubChem CID 69169633) has the molecular formula C23H29ClN2O6 and a molecular weight of 464.95 g/mol. Its IUPAC name is 7-O-benzyl 1-O-methyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)heptanedioate;hydrochloride.
| Compound Name | 7-O-benzyl 1-O-methyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)heptanedioate;hydrochloride |
|---|---|
| PubChem CID | 69169633 |
| Molecular Formula | C23H29ClN2O6 |
| Molecular Weight | 464.95 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 7-O-benzyl 1-O-methyl (2S)-6-amino-2-(phenylmethoxycarbonylamino)heptanedioate;hydrochloride |
| SMILES | COC(=O)[C@H](CCCC(N)C(=O)OCc1ccccc1)NC(=O)OCc1ccccc1.Cl |
| InChI | InChI=1S/C23H28N2O6.ClH/c1-29-22(27)20(25-23(28)31-16-18-11-6-3-7-12-18)14-8-13-19(24)21(26)30-15-17-9-4-2-5-10-17;/h2-7,9-12,19-20H,8,13-16,24H2,1H3,(H,25,28);1H/t19?,20-;/m0./s1 |
| InChIKey | MFXRSCSDXGNXGU-XSAAWUBDSA-N |
| XLogP | 3.12 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.95 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|