C15H19NO5 — CID 11426371
methyl (2R)-6-oxo-2-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 11426371) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is methyl (2R)-6-oxo-2-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | methyl (2R)-6-oxo-2-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 11426371 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | methyl (2R)-6-oxo-2-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | COC(=O)[C@@H](CCCC=O)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H19NO5/c1-20-14(18)13(9-5-6-10-17)16-15(19)21-11-12-7-3-2-4-8-12/h2-4,7-8,10,13H,5-6,9,11H2,1H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | YWQZPOUPTXQLEG-CYBMUJFWSA-N |
| XLogP | 1.82 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|