C16H18F5NO4 — CID 90115438
methyl 6,6,7,7,7-pentafluoro-2-(phenylmethoxycarbonylamino)heptanoate (PubChem CID 90115438) has the molecular formula C16H18F5NO4 and a molecular weight of 383.31 g/mol. Its IUPAC name is methyl 6,6,7,7,7-pentafluoro-2-(phenylmethoxycarbonylamino)heptanoate.
| Compound Name | methyl 6,6,7,7,7-pentafluoro-2-(phenylmethoxycarbonylamino)heptanoate |
|---|---|
| PubChem CID | 90115438 |
| Molecular Formula | C16H18F5NO4 |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | methyl 6,6,7,7,7-pentafluoro-2-(phenylmethoxycarbonylamino)heptanoate |
| SMILES | COC(=O)C(CCCC(F)(F)C(F)(F)F)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H18F5NO4/c1-25-13(23)12(8-5-9-15(17,18)16(19,20)21)22-14(24)26-10-11-6-3-2-4-7-11/h2-4,6-7,12H,5,8-10H2,1H3,(H,22,24) |
| InChIKey | QBTNMSIPDMPTHH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|