C16H20F5NO3 — CID 129410876
benzyl N-[(3S)-6,6,7,7,7-pentafluoro-2-hydroxy-2-methylheptan-3-yl]carbamate (PubChem CID 129410876) has the molecular formula C16H20F5NO3 and a molecular weight of 369.33 g/mol. Its IUPAC name is benzyl N-[(3S)-6,6,7,7,7-pentafluoro-2-hydroxy-2-methylheptan-3-yl]carbamate.
| Compound Name | benzyl N-[(3S)-6,6,7,7,7-pentafluoro-2-hydroxy-2-methylheptan-3-yl]carbamate |
|---|---|
| PubChem CID | 129410876 |
| Molecular Formula | C16H20F5NO3 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | benzyl N-[(3S)-6,6,7,7,7-pentafluoro-2-hydroxy-2-methylheptan-3-yl]carbamate |
| SMILES | CC(C)(O)[C@H](CCC(F)(F)C(F)(F)F)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H20F5NO3/c1-14(2,24)12(8-9-15(17,18)16(19,20)21)22-13(23)25-10-11-6-4-3-5-7-11/h3-7,12,24H,8-10H2,1-2H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | HLKWPMPGLRLEAC-LBPRGKRZSA-N |
| XLogP | 4.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|