C33H25F26NO3 — CID 11707866
benzyl N-[(2S)-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-3-hydroxy-1-phenyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)undecan-2-yl]carbamate (PubChem CID 11707866) has the molecular formula C33H25F26NO3 and a molecular weight of 977.51 g/mol. Its IUPAC name is benzyl N-[(2S)-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-3-hydroxy-1-phenyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)undecan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-3-hydroxy-1-phenyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)undecan-2-yl]carbamate |
|---|---|
| PubChem CID | 11707866 |
| Molecular Formula | C33H25F26NO3 |
| Molecular Weight | 977.51 g/mol |
| Exact Mass | 977.14 |
| IUPAC Name | benzyl N-[(2S)-6,6,7,7,8,8,9,9,10,10,11,11,11-tridecafluoro-3-hydroxy-1-phenyl-3-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)undecan-2-yl]carbamate |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(O)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C33H25F26NO3/c34-22(35,24(38,39)26(42,43)28(46,47)30(50,51)32(54,55)56)13-11-21(62,12-14-23(36,37)25(40,41)27(44,45)29(48,49)31(52,53)33(57,58)59)19(15-17-7-3-1-4-8-17)60-20(61)63-16-18-9-5-2-6-10-18/h1-10,19,62H,11-16H2,(H,60,61)/t19-/m0/s1 |
| InChIKey | ROSMLLOPBAZCIE-IBGZPJMESA-N |
| XLogP | 12.29 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 977.51 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|