C14H11F9O2 — CID 177435573
benzyl 4,4,5,5,6,6,7,7,7-nonafluoroheptanoate (PubChem CID 177435573) has the molecular formula C14H11F9O2 and a molecular weight of 382.22 g/mol. Its IUPAC name is benzyl 4,4,5,5,6,6,7,7,7-nonafluoroheptanoate.
| Compound Name | benzyl 4,4,5,5,6,6,7,7,7-nonafluoroheptanoate |
|---|---|
| PubChem CID | 177435573 |
| Molecular Formula | C14H11F9O2 |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 382.06 |
| IUPAC Name | benzyl 4,4,5,5,6,6,7,7,7-nonafluoroheptanoate |
| SMILES | O=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C14H11F9O2/c15-11(16,12(17,18)13(19,20)14(21,22)23)7-6-10(24)25-8-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | SFHUBIRIRWPKLI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|