About 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate
5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate (PubChem CID 162536691) has the molecular formula C13H11F3O5
and a molecular weight of 304.22 g/mol. Its IUPAC name is 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate.
Molecular Properties
| Compound Name | 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate |
| PubChem CID | 162536691 |
| Molecular Formula | C13H11F3O5 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate |
| SMILES | O=C(CCC(=O)C(=O)OC(F)(F)F)OCc1ccccc1 |
| InChI | InChI=1S/C13H11F3O5/c14-13(15,16)21-12(19)10(17)6-7-11(18)20-8-9-4-2-1-3-5-9/h1-5H,6-8H2 |
| InChIKey | YZEKCNRMIUAVGF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate?
The IUPAC name of 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate (CID 162536691) is 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate.
What is the SMILES notation for 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate?
The canonical SMILES for 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate is O=C(CCC(=O)C(=O)OC(F)(F)F)OCc1ccccc1.
What is the InChIKey of 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate?
The InChIKey is YZEKCNRMIUAVGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11F3O5/c14-13(15,16)21-12(19)10(17)6-7-11(18)20-8-9-4-2-1-3-5-9/h1-5H,6-8H2.
What are the key properties of 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate?
5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate has a molecular weight of 304.22 g/mol, XLogP of 2.14, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-benzyl 1-O-(trifluoromethyl) 2-oxopentanedioate is sourced from PubChem (CID 162536691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).