About dibenzyl 4-oxoheptanedioate
dibenzyl 4-oxoheptanedioate (PubChem CID 14639376) has the molecular formula C21H22O5
and a molecular weight of 354.40 g/mol. Its IUPAC name is dibenzyl 4-oxoheptanedioate.
Molecular Properties
| Compound Name | dibenzyl 4-oxoheptanedioate |
| PubChem CID | 14639376 |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | dibenzyl 4-oxoheptanedioate |
| SMILES | O=C(CCC(=O)OCc1ccccc1)CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H22O5/c22-19(11-13-20(23)25-15-17-7-3-1-4-8-17)12-14-21(24)26-16-18-9-5-2-6-10-18/h1-10H,11-16H2 |
| InChIKey | CYMARVGAVHILJX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze dibenzyl 4-oxoheptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl 4-oxoheptanedioate?
The IUPAC name of dibenzyl 4-oxoheptanedioate (CID 14639376) is dibenzyl 4-oxoheptanedioate.
What is the SMILES notation for dibenzyl 4-oxoheptanedioate?
The canonical SMILES for dibenzyl 4-oxoheptanedioate is O=C(CCC(=O)OCc1ccccc1)CCC(=O)OCc1ccccc1.
What is the InChIKey of dibenzyl 4-oxoheptanedioate?
The InChIKey is CYMARVGAVHILJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22O5/c22-19(11-13-20(23)25-15-17-7-3-1-4-8-17)12-14-21(24)26-16-18-9-5-2-6-10-18/h1-10H,11-16H2.
What are the key properties of dibenzyl 4-oxoheptanedioate?
dibenzyl 4-oxoheptanedioate has a molecular weight of 354.40 g/mol, XLogP of 3.60, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl 4-oxoheptanedioate is sourced from PubChem (CID 14639376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).