About benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid
benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid (PubChem CID 130277259) has the molecular formula C14H18ClNO5
and a molecular weight of 315.75 g/mol. Its IUPAC name is benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid.
Molecular Properties
| Compound Name | benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid |
| PubChem CID | 130277259 |
| Molecular Formula | C14H18ClNO5 |
| Molecular Weight | 315.75 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid |
| SMILES | NCC(=O)CCC(=O)OCc1ccccc1.O=C(O)CCl |
| InChI | InChI=1S/C12H15NO3.C2H3ClO2/c13-8-11(14)6-7-12(15)16-9-10-4-2-1-3-5-10;3-1-2(4)5/h1-5H,6-9,13H2;1H2,(H,4,5) |
| InChIKey | CQWDNXKOVIIZOY-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.75 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid?
The IUPAC name of benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid (CID 130277259) is benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid.
What is the SMILES notation for benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid?
The canonical SMILES for benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid is NCC(=O)CCC(=O)OCc1ccccc1.O=C(O)CCl.
What is the InChIKey of benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid?
The InChIKey is CQWDNXKOVIIZOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO3.C2H3ClO2/c13-8-11(14)6-7-12(15)16-9-10-4-2-1-3-5-10;3-1-2(4)5/h1-5H,6-9,13H2;1H2,(H,4,5).
What are the key properties of benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid?
benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid has a molecular weight of 315.75 g/mol, XLogP of 1.35, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5-amino-4-oxopentanoate;2-chloroacetic acid is sourced from PubChem (CID 130277259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).