About benzyl 6-chloro-5-oxohexanoate
benzyl 6-chloro-5-oxohexanoate (PubChem CID 170561744) has the molecular formula C13H15ClO3
and a molecular weight of 254.71 g/mol. Its IUPAC name is benzyl 6-chloro-5-oxohexanoate.
Molecular Properties
| Compound Name | benzyl 6-chloro-5-oxohexanoate |
| PubChem CID | 170561744 |
| Molecular Formula | C13H15ClO3 |
| Molecular Weight | 254.71 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | benzyl 6-chloro-5-oxohexanoate |
| SMILES | O=C(CCl)CCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C13H15ClO3/c14-9-12(15)7-4-8-13(16)17-10-11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2 |
| InChIKey | VNBDMZAOODRWGV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.71 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze benzyl 6-chloro-5-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 6-chloro-5-oxohexanoate?
The IUPAC name of benzyl 6-chloro-5-oxohexanoate (CID 170561744) is benzyl 6-chloro-5-oxohexanoate.
What is the SMILES notation for benzyl 6-chloro-5-oxohexanoate?
The canonical SMILES for benzyl 6-chloro-5-oxohexanoate is O=C(CCl)CCCC(=O)OCc1ccccc1.
What is the InChIKey of benzyl 6-chloro-5-oxohexanoate?
The InChIKey is VNBDMZAOODRWGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClO3/c14-9-12(15)7-4-8-13(16)17-10-11-5-2-1-3-6-11/h1-3,5-6H,4,7-10H2.
What are the key properties of benzyl 6-chloro-5-oxohexanoate?
benzyl 6-chloro-5-oxohexanoate has a molecular weight of 254.71 g/mol, XLogP of 2.71, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 6-chloro-5-oxohexanoate is sourced from PubChem (CID 170561744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).