About benzyl 5-hydroxypentanoate
benzyl 5-hydroxypentanoate (PubChem CID 19788674) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is benzyl 5-hydroxypentanoate.
Molecular Properties
| Compound Name | benzyl 5-hydroxypentanoate |
| PubChem CID | 19788674 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | benzyl 5-hydroxypentanoate |
| SMILES | O=C(CCCCO)OCc1ccccc1 |
| InChI | InChI=1S/C12H16O3/c13-9-5-4-8-12(14)15-10-11-6-2-1-3-7-11/h1-3,6-7,13H,4-5,8-10H2 |
| InChIKey | NQTOFIXXPCKZTG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze benzyl 5-hydroxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5-hydroxypentanoate?
The IUPAC name of benzyl 5-hydroxypentanoate (CID 19788674) is benzyl 5-hydroxypentanoate.
What is the SMILES notation for benzyl 5-hydroxypentanoate?
The canonical SMILES for benzyl 5-hydroxypentanoate is O=C(CCCCO)OCc1ccccc1.
What is the InChIKey of benzyl 5-hydroxypentanoate?
The InChIKey is NQTOFIXXPCKZTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c13-9-5-4-8-12(14)15-10-11-6-2-1-3-7-11/h1-3,6-7,13H,4-5,8-10H2.
What are the key properties of benzyl 5-hydroxypentanoate?
benzyl 5-hydroxypentanoate has a molecular weight of 208.26 g/mol, XLogP of 1.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5-hydroxypentanoate is sourced from PubChem (CID 19788674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).