About 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate
3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate (PubChem CID 159144991) has the molecular formula C23H32ClNO6
and a molecular weight of 453.96 g/mol. Its IUPAC name is 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate.
Molecular Properties
| Compound Name | 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate |
| PubChem CID | 159144991 |
| Molecular Formula | C23H32ClNO6 |
| Molecular Weight | 453.96 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate |
| SMILES | NCCCO.O=C(CCCCO)OCc1ccccc1.O=C(Cl)OCc1ccccc1 |
| InChI | InChI=1S/C12H16O3.C8H7ClO2.C3H9NO/c13-9-5-4-8-12(14)15-10-11-6-2-1-3-7-11;9-8(10)11-6-7-4-2-1-3-5-7;4-2-1-3-5/h1-3,6-7,13H,4-5,8-10H2;1-5H,6H2;5H,1-4H2 |
| InChIKey | KIOJULXRPCZYLE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.96 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate?
The IUPAC name of 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate (CID 159144991) is 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate.
What is the SMILES notation for 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate?
The canonical SMILES for 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate is NCCCO.O=C(CCCCO)OCc1ccccc1.O=C(Cl)OCc1ccccc1.
What is the InChIKey of 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate?
The InChIKey is KIOJULXRPCZYLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3.C8H7ClO2.C3H9NO/c13-9-5-4-8-12(14)15-10-11-6-2-1-3-7-11;9-8(10)11-6-7-4-2-1-3-5-7;4-2-1-3-5/h1-3,6-7,13H,4-5,8-10H2;1-5H,6H2;5H,1-4H2.
What are the key properties of 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate?
3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate has a molecular weight of 453.96 g/mol, XLogP of 3.78, 10 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropan-1-ol;benzyl carbonochloridate;benzyl 5-hydroxypentanoate is sourced from PubChem (CID 159144991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).