About 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate
2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate (PubChem CID 130277295) has the molecular formula C17H24ClNO5
and a molecular weight of 357.83 g/mol. Its IUPAC name is 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate.
Molecular Properties
| Compound Name | 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate |
| PubChem CID | 130277295 |
| Molecular Formula | C17H24ClNO5 |
| Molecular Weight | 357.83 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate |
| SMILES | CC(C)c1ccc(COC(=O)CCC(=O)CN)cc1.O=C(O)CCl |
| InChI | InChI=1S/C15H21NO3.C2H3ClO2/c1-11(2)13-5-3-12(4-6-13)10-19-15(18)8-7-14(17)9-16;3-1-2(4)5/h3-6,11H,7-10,16H2,1-2H3;1H2,(H,4,5) |
| InChIKey | AFNAZCGHHAKOTR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.83 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate?
The IUPAC name of 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate (CID 130277295) is 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate.
What is the SMILES notation for 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate?
The canonical SMILES for 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate is CC(C)c1ccc(COC(=O)CCC(=O)CN)cc1.O=C(O)CCl.
What is the InChIKey of 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate?
The InChIKey is AFNAZCGHHAKOTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3.C2H3ClO2/c1-11(2)13-5-3-12(4-6-13)10-19-15(18)8-7-14(17)9-16;3-1-2(4)5/h3-6,11H,7-10,16H2,1-2H3;1H2,(H,4,5).
What are the key properties of 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate?
2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate has a molecular weight of 357.83 g/mol, XLogP of 2.47, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloroacetic acid;(4-propan-2-ylphenyl)methyl 5-amino-4-oxopentanoate is sourced from PubChem (CID 130277295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).