C18H20ClNO2 — CID 60562428
(6-chloro-3-pyridinyl)methyl 3-(4-propan-2-ylphenyl)propanoate (PubChem CID 60562428) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 3-(4-propan-2-ylphenyl)propanoate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 3-(4-propan-2-ylphenyl)propanoate |
|---|---|
| PubChem CID | 60562428 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 3-(4-propan-2-ylphenyl)propanoate |
| SMILES | CC(C)c1ccc(CCC(=O)OCc2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C18H20ClNO2/c1-13(2)16-7-3-14(4-8-16)6-10-18(21)22-12-15-5-9-17(19)20-11-15/h3-5,7-9,11,13H,6,10,12H2,1-2H3 |
| InChIKey | DDNWONUFNRZVPI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|