C18H19ClN4O2 — CID 30699981
(6-chloro-3-pyridinyl)methyl 3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoate (PubChem CID 30699981) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoate |
|---|---|
| PubChem CID | 30699981 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 3-(2,5,7-trimethylpyrazolo[1,5-a]pyrimidin-6-yl)propanoate |
| SMILES | Cc1cc2nc(C)c(CCC(=O)OCc3ccc(Cl)nc3)c(C)n2n1 |
| InChI | InChI=1S/C18H19ClN4O2/c1-11-8-17-21-12(2)15(13(3)23(17)22-11)5-7-18(24)25-10-14-4-6-16(19)20-9-14/h4,6,8-9H,5,7,10H2,1-3H3 |
| InChIKey | BLKPNAOZNMKMDN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|