C16H17ClN2O4 — CID 134448147
(4-methoxyphenyl)methyl N-[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]carbamate (PubChem CID 134448147) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 134448147 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (4-methoxyphenyl)methyl N-[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]carbamate |
| SMILES | COc1ccc(COC(=O)NC[C@H](O)c2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C16H17ClN2O4/c1-22-13-5-2-11(3-6-13)10-23-16(21)19-9-14(20)12-4-7-15(17)18-8-12/h2-8,14,20H,9-10H2,1H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | YHMCOGWEILLUCX-AWEZNQCLSA-N |
| XLogP | 2.70 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|