C16H17ClN2O4 — CID 140543896
[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl] N-[2-(4-hydroxyphenyl)ethyl]carbamate (PubChem CID 140543896) has the molecular formula C16H17ClN2O4 and a molecular weight of 336.78 g/mol. Its IUPAC name is [(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl] N-[2-(4-hydroxyphenyl)ethyl]carbamate.
| Compound Name | [(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl] N-[2-(4-hydroxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 140543896 |
| Molecular Formula | C16H17ClN2O4 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl] N-[2-(4-hydroxyphenyl)ethyl]carbamate |
| SMILES | O=C(NCCc1ccc(O)cc1)OC[C@H](O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C16H17ClN2O4/c17-15-6-3-12(9-19-15)14(21)10-23-16(22)18-8-7-11-1-4-13(20)5-2-11/h1-6,9,14,20-21H,7-8,10H2,(H,18,22)/t14-/m0/s1 |
| InChIKey | DZVKHIRUSRWYPX-AWEZNQCLSA-N |
| XLogP | 2.44 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|