C22H37ClN2O — CID 144822008
1-(6-chloro-3-pyridinyl)-2-[2-(4-methylphenyl)ethylamino]ethanol;ethane (PubChem CID 144822008) has the molecular formula C22H37ClN2O and a molecular weight of 381.00 g/mol. Its IUPAC name is 1-(6-chloro-3-pyridinyl)-2-[2-(4-methylphenyl)ethylamino]ethanol;ethane.
| Compound Name | 1-(6-chloro-3-pyridinyl)-2-[2-(4-methylphenyl)ethylamino]ethanol;ethane |
|---|---|
| PubChem CID | 144822008 |
| Molecular Formula | C22H37ClN2O |
| Molecular Weight | 381.00 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 1-(6-chloro-3-pyridinyl)-2-[2-(4-methylphenyl)ethylamino]ethanol;ethane |
| SMILES | CC.CC.CC.Cc1ccc(CCNCC(O)c2ccc(Cl)nc2)cc1 |
| InChI | InChI=1S/C16H19ClN2O.3C2H6/c1-12-2-4-13(5-3-12)8-9-18-11-15(20)14-6-7-16(17)19-10-14;3*1-2/h2-7,10,15,18,20H,8-9,11H2,1H3;3*1-2H3 |
| InChIKey | SZCZEQQHTUPNQG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.00 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|