C23H28ClN5O3 — CID 139419356
4-[2-[[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]-N-[(3-ethoxy-1H-pyrazol-5-yl)methyl]-N-methylbenzamide (PubChem CID 139419356) has the molecular formula C23H28ClN5O3 and a molecular weight of 457.96 g/mol. Its IUPAC name is 4-[2-[[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]-N-[(3-ethoxy-1H-pyrazol-5-yl)methyl]-N-methylbenzamide.
| Compound Name | 4-[2-[[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]-N-[(3-ethoxy-1H-pyrazol-5-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 139419356 |
| Molecular Formula | C23H28ClN5O3 |
| Molecular Weight | 457.96 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | 4-[2-[[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]-N-[(3-ethoxy-1H-pyrazol-5-yl)methyl]-N-methylbenzamide |
| SMILES | CCOc1cc(CN(C)C(=O)c2ccc(CCNC[C@H](O)c3ccc(Cl)nc3)cc2)[nH]n1 |
| InChI | InChI=1S/C23H28ClN5O3/c1-3-32-22-12-19(27-28-22)15-29(2)23(31)17-6-4-16(5-7-17)10-11-25-14-20(30)18-8-9-21(24)26-13-18/h4-9,12-13,20,25,30H,3,10-11,14-15H2,1-2H3,(H,27,28)/t20-/m0/s1 |
| InChIKey | HDCXEVLLVSPMPJ-FQEVSTJZSA-N |
| XLogP | 2.99 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.96 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|