C24H22ClN3OS — CID 87976518
(1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]ethylamino]ethanol (PubChem CID 87976518) has the molecular formula C24H22ClN3OS and a molecular weight of 435.98 g/mol. Its IUPAC name is (1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]ethylamino]ethanol.
| Compound Name | (1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]ethylamino]ethanol |
|---|---|
| PubChem CID | 87976518 |
| Molecular Formula | C24H22ClN3OS |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | (1R)-1-(6-chloro-3-pyridinyl)-2-[2-[4-(2-phenyl-1,3-thiazol-4-yl)phenyl]ethylamino]ethanol |
| SMILES | O[C@@H](CNCCc1ccc(-c2csc(-c3ccccc3)n2)cc1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C24H22ClN3OS/c25-23-11-10-20(14-27-23)22(29)15-26-13-12-17-6-8-18(9-7-17)21-16-30-24(28-21)19-4-2-1-3-5-19/h1-11,14,16,22,26,29H,12-13,15H2/t22-/m0/s1 |
| InChIKey | MPGGHDPQBMVQIM-QFIPXVFZSA-N |
| XLogP | 5.39 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|