C22H25Cl3N4O4S — CID 87968107
2-amino-5-[4-[2-[[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylbenzamide;dihydrochloride (PubChem CID 87968107) has the molecular formula C22H25Cl3N4O4S and a molecular weight of 547.89 g/mol. Its IUPAC name is 2-amino-5-[4-[2-[[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylbenzamide;dihydrochloride.
| Compound Name | 2-amino-5-[4-[2-[[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylbenzamide;dihydrochloride |
|---|---|
| PubChem CID | 87968107 |
| Molecular Formula | C22H25Cl3N4O4S |
| Molecular Weight | 547.89 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | 2-amino-5-[4-[2-[[(2R)-2-(6-chloro-3-pyridinyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylbenzamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)c1cc(S(=O)(=O)c2ccc(CCNC[C@H](O)c3ccc(Cl)nc3)cc2)ccc1N |
| InChI | InChI=1S/C22H23ClN4O4S.2ClH/c23-21-8-3-15(12-27-21)20(28)13-26-10-9-14-1-4-16(5-2-14)32(30,31)17-6-7-19(24)18(11-17)22(25)29;;/h1-8,11-12,20,26,28H,9-10,13,24H2,(H2,25,29);2*1H/t20-;;/m0../s1 |
| InChIKey | AVPCGDOVJHVBJL-FJSYBICCSA-N |
| XLogP | 2.96 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.89 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|