C25H26ClNO6S — CID 90768243
methyl 2-[4-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylphenoxy]acetate (PubChem CID 90768243) has the molecular formula C25H26ClNO6S and a molecular weight of 504.00 g/mol. Its IUPAC name is methyl 2-[4-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylphenoxy]acetate.
| Compound Name | methyl 2-[4-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylphenoxy]acetate |
|---|---|
| PubChem CID | 90768243 |
| Molecular Formula | C25H26ClNO6S |
| Molecular Weight | 504.00 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | methyl 2-[4-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(S(=O)(=O)c2ccc(CCNCC(O)c3cccc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C25H26ClNO6S/c1-32-25(29)17-33-21-7-11-23(12-8-21)34(30,31)22-9-5-18(6-10-22)13-14-27-16-24(28)19-3-2-4-20(26)15-19/h2-12,15,24,27-28H,13-14,16-17H2,1H3 |
| InChIKey | HGLRKLXSMVPBDZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.00 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|