C25H24ClNO5 — CID 24824227
2-[4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]benzoyl]phenoxy]acetic acid (PubChem CID 24824227) has the molecular formula C25H24ClNO5 and a molecular weight of 453.92 g/mol. Its IUPAC name is 2-[4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]benzoyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]benzoyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 24824227 |
| Molecular Formula | C25H24ClNO5 |
| Molecular Weight | 453.92 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 2-[4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]benzoyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(C(=O)c2ccc(CCNC[C@H](O)c3cccc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C25H24ClNO5/c26-21-3-1-2-20(14-21)23(28)15-27-13-12-17-4-6-18(7-5-17)25(31)19-8-10-22(11-9-19)32-16-24(29)30/h1-11,14,23,27-28H,12-13,15-16H2,(H,29,30)/t23-/m0/s1 |
| InChIKey | DWACOCWRGJMZMP-QHCPKHFHSA-N |
| XLogP | 3.90 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.92 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|