C22H22ClNO2 — CID 14368658
4-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]phenol (PubChem CID 14368658) has the molecular formula C22H22ClNO2 and a molecular weight of 367.88 g/mol. Its IUPAC name is 4-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]phenol.
| Compound Name | 4-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]phenol |
|---|---|
| PubChem CID | 14368658 |
| Molecular Formula | C22H22ClNO2 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | 4-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]phenol |
| SMILES | Oc1ccc(-c2ccc(CCNCC(O)c3cccc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C22H22ClNO2/c23-20-3-1-2-19(14-20)22(26)15-24-13-12-16-4-6-17(7-5-16)18-8-10-21(25)11-9-18/h1-11,14,22,24-26H,12-13,15H2 |
| InChIKey | IXUIBHBJTWFYCD-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|