C23H21ClFNO3 — CID 24823130
4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-fluorobenzoic acid (PubChem CID 24823130) has the molecular formula C23H21ClFNO3 and a molecular weight of 413.88 g/mol. Its IUPAC name is 4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-fluorobenzoic acid.
| Compound Name | 4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 24823130 |
| Molecular Formula | C23H21ClFNO3 |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-[4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]-2-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(CCNC[C@H](O)c3cccc(Cl)c3)cc2)cc1F |
| InChI | InChI=1S/C23H21ClFNO3/c24-19-3-1-2-18(12-19)22(27)14-26-11-10-15-4-6-16(7-5-15)17-8-9-20(23(28)29)21(25)13-17/h1-9,12-13,22,26-27H,10-11,14H2,(H,28,29)/t22-/m0/s1 |
| InChIKey | WBFWOCOUPSZWOW-QFIPXVFZSA-N |
| XLogP | 4.71 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|