C24H23Cl2NO3 — CID 69056294
2-chloro-4-[4-[3-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]benzoic acid (PubChem CID 69056294) has the molecular formula C24H23Cl2NO3 and a molecular weight of 444.36 g/mol. Its IUPAC name is 2-chloro-4-[4-[3-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]benzoic acid.
| Compound Name | 2-chloro-4-[4-[3-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 69056294 |
| Molecular Formula | C24H23Cl2NO3 |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.11 |
| IUPAC Name | 2-chloro-4-[4-[3-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(CCCNC[C@H](O)c3cccc(Cl)c3)cc2)cc1Cl |
| InChI | InChI=1S/C24H23Cl2NO3/c25-20-5-1-4-19(13-20)23(28)15-27-12-2-3-16-6-8-17(9-7-16)18-10-11-21(24(29)30)22(26)14-18/h1,4-11,13-14,23,27-28H,2-3,12,15H2,(H,29,30)/t23-/m0/s1 |
| InChIKey | CCASQBSXKDEGQG-QHCPKHFHSA-N |
| XLogP | 5.61 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|