C16H19Cl2NO2 — CID 67873161
4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenol;hydrochloride (PubChem CID 67873161) has the molecular formula C16H19Cl2NO2 and a molecular weight of 328.24 g/mol. Its IUPAC name is 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenol;hydrochloride.
| Compound Name | 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 67873161 |
| Molecular Formula | C16H19Cl2NO2 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenol;hydrochloride |
| SMILES | Cl.Oc1ccc(CCNCC(O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H18ClNO2.ClH/c17-14-3-1-2-13(10-14)16(20)11-18-9-8-12-4-6-15(19)7-5-12;/h1-7,10,16,18-20H,8-9,11H2;1H |
| InChIKey | AZANSEGKOHVXJD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|