C23H22Cl3NO3 — CID 24823934
4-[2-chloro-4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]benzoic acid;hydrochloride (PubChem CID 24823934) has the molecular formula C23H22Cl3NO3 and a molecular weight of 466.79 g/mol. Its IUPAC name is 4-[2-chloro-4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]benzoic acid;hydrochloride.
| Compound Name | 4-[2-chloro-4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 24823934 |
| Molecular Formula | C23H22Cl3NO3 |
| Molecular Weight | 466.79 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | 4-[2-chloro-4-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]benzoic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc(-c2ccc(CCNC[C@H](O)c3cccc(Cl)c3)cc2Cl)cc1 |
| InChI | InChI=1S/C23H21Cl2NO3.ClH/c24-19-3-1-2-18(13-19)22(27)14-26-11-10-15-4-9-20(21(25)12-15)16-5-7-17(8-6-16)23(28)29;/h1-9,12-13,22,26-27H,10-11,14H2,(H,28,29);1H/t22-;/m0./s1 |
| InChIKey | FZFVQADVDVVGND-FTBISJDPSA-N |
| XLogP | 5.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.79 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|