C24H23Cl2NO4 — CID 69054927
3-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]-6H-benzo[c]chromene-8-carboxylic acid;hydrochloride (PubChem CID 69054927) has the molecular formula C24H23Cl2NO4 and a molecular weight of 460.36 g/mol. Its IUPAC name is 3-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]-6H-benzo[c]chromene-8-carboxylic acid;hydrochloride.
| Compound Name | 3-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]-6H-benzo[c]chromene-8-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 69054927 |
| Molecular Formula | C24H23Cl2NO4 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | 3-[2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]-6H-benzo[c]chromene-8-carboxylic acid;hydrochloride |
| SMILES | Cl.O=C(O)c1ccc2c(c1)COc1cc(CCNC[C@H](O)c3cccc(Cl)c3)ccc1-2 |
| InChI | InChI=1S/C24H22ClNO4.ClH/c25-19-3-1-2-16(12-19)22(27)13-26-9-8-15-4-6-21-20-7-5-17(24(28)29)11-18(20)14-30-23(21)10-15;/h1-7,10-12,22,26-27H,8-9,13-14H2,(H,28,29);1H/t22-;/m0./s1 |
| InChIKey | AIGFXPBMSGAYMD-FTBISJDPSA-N |
| XLogP | 4.89 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|