C24H25Cl2NO4S — CID 69057588
2-[4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfanylphenoxy]acetic acid;hydrochloride (PubChem CID 69057588) has the molecular formula C24H25Cl2NO4S and a molecular weight of 494.44 g/mol. Its IUPAC name is 2-[4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfanylphenoxy]acetic acid;hydrochloride.
| Compound Name | 2-[4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfanylphenoxy]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 69057588 |
| Molecular Formula | C24H25Cl2NO4S |
| Molecular Weight | 494.44 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | 2-[4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfanylphenoxy]acetic acid;hydrochloride |
| SMILES | Cl.O=C(O)COc1ccc(Sc2ccc(CCNC[C@@H](O)c3cccc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C24H24ClNO4S.ClH/c25-19-3-1-2-18(14-19)23(27)15-26-13-12-17-4-8-21(9-5-17)31-22-10-6-20(7-11-22)30-16-24(28)29;/h1-11,14,23,26-27H,12-13,15-16H2,(H,28,29);1H/t23-;/m1./s1 |
| InChIKey | UFXHMCOQTXMYFU-GNAFDRTKSA-N |
| XLogP | 5.24 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.44 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|