C18H22Cl2N2O3 — CID 67791193
2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]acetamide;hydrochloride (PubChem CID 67791193) has the molecular formula C18H22Cl2N2O3 and a molecular weight of 385.29 g/mol. Its IUPAC name is 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]acetamide;hydrochloride.
| Compound Name | 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 67791193 |
| Molecular Formula | C18H22Cl2N2O3 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]acetamide;hydrochloride |
| SMILES | Cl.NC(=O)Cc1ccc(OCCNCC(O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H21ClN2O3.ClH/c19-15-3-1-2-14(11-15)17(22)12-21-8-9-24-16-6-4-13(5-7-16)10-18(20)23;/h1-7,11,17,21-22H,8-10,12H2,(H2,20,23);1H |
| InChIKey | RRVOUAQYILKNNC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|