C27H31Cl2NO4 — CID 69102769
4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-2-(2-methylpropyl)benzoic acid;hydrochloride (PubChem CID 69102769) has the molecular formula C27H31Cl2NO4 and a molecular weight of 504.45 g/mol. Its IUPAC name is 4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-2-(2-methylpropyl)benzoic acid;hydrochloride.
| Compound Name | 4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-2-(2-methylpropyl)benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 69102769 |
| Molecular Formula | C27H31Cl2NO4 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethoxy]phenyl]-2-(2-methylpropyl)benzoic acid;hydrochloride |
| SMILES | CC(C)Cc1cc(-c2ccc(OCCNC[C@@H](O)c3cccc(Cl)c3)cc2)ccc1C(=O)O.Cl |
| InChI | InChI=1S/C27H30ClNO4.ClH/c1-18(2)14-22-15-20(8-11-25(22)27(31)32)19-6-9-24(10-7-19)33-13-12-29-17-26(30)21-4-3-5-23(28)16-21;/h3-11,15-16,18,26,29-30H,12-14,17H2,1-2H3,(H,31,32);1H/t26-;/m1./s1 |
| InChIKey | FJTAGRLRABWGCD-UFTMZEDQSA-N |
| XLogP | 6.03 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|