C28H35ClN2O5S — CID 69103383
4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]-2-(2-methylpropyl)-N-methylsulfonylbenzamide;hydrochloride (PubChem CID 69103383) has the molecular formula C28H35ClN2O5S and a molecular weight of 547.12 g/mol. Its IUPAC name is 4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]-2-(2-methylpropyl)-N-methylsulfonylbenzamide;hydrochloride.
| Compound Name | 4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]-2-(2-methylpropyl)-N-methylsulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 69103383 |
| Molecular Formula | C28H35ClN2O5S |
| Molecular Weight | 547.12 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | 4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethoxy]phenyl]-2-(2-methylpropyl)-N-methylsulfonylbenzamide;hydrochloride |
| SMILES | CC(C)Cc1cc(-c2ccc(OCCNC[C@@H](O)c3ccccc3)cc2)ccc1C(=O)NS(C)(=O)=O.Cl |
| InChI | InChI=1S/C28H34N2O5S.ClH/c1-20(2)17-24-18-23(11-14-26(24)28(32)30-36(3,33)34)21-9-12-25(13-10-21)35-16-15-29-19-27(31)22-7-5-4-6-8-22;/h4-14,18,20,27,29,31H,15-17,19H2,1-3H3,(H,30,32);1H/t27-;/m1./s1 |
| InChIKey | FGMVJRQRPVGIGJ-HZPIKELBSA-N |
| XLogP | 4.37 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.12 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|