C27H33ClN2O6S — CID 69103515
4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-(2-methoxyethoxy)-N-methylsulfonylbenzamide;hydrochloride (PubChem CID 69103515) has the molecular formula C27H33ClN2O6S and a molecular weight of 549.09 g/mol. Its IUPAC name is 4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-(2-methoxyethoxy)-N-methylsulfonylbenzamide;hydrochloride.
| Compound Name | 4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-(2-methoxyethoxy)-N-methylsulfonylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 69103515 |
| Molecular Formula | C27H33ClN2O6S |
| Molecular Weight | 549.09 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-2-(2-methoxyethoxy)-N-methylsulfonylbenzamide;hydrochloride |
| SMILES | COCCOc1cc(-c2ccc(CCNC[C@@H](O)c3ccccc3)cc2)ccc1C(=O)NS(C)(=O)=O.Cl |
| InChI | InChI=1S/C27H32N2O6S.ClH/c1-34-16-17-35-26-18-23(12-13-24(26)27(31)29-36(2,32)33)21-10-8-20(9-11-21)14-15-28-19-25(30)22-6-4-3-5-7-22;/h3-13,18,25,28,30H,14-17,19H2,1-2H3,(H,29,31);1H/t25-;/m1./s1 |
| InChIKey | PZMTXQSQQBBZNM-VQIWEWKSSA-N |
| XLogP | 3.36 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.09 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|