C26H27F3N2O5S — CID 69103679
4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-methylsulfonyl-2-(2,2,2-trifluoroethoxy)benzamide (PubChem CID 69103679) has the molecular formula C26H27F3N2O5S and a molecular weight of 536.57 g/mol. Its IUPAC name is 4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-methylsulfonyl-2-(2,2,2-trifluoroethoxy)benzamide.
| Compound Name | 4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-methylsulfonyl-2-(2,2,2-trifluoroethoxy)benzamide |
|---|---|
| PubChem CID | 69103679 |
| Molecular Formula | C26H27F3N2O5S |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.16 |
| IUPAC Name | 4-[4-[2-[[(2S)-2-hydroxy-2-phenylethyl]amino]ethyl]phenyl]-N-methylsulfonyl-2-(2,2,2-trifluoroethoxy)benzamide |
| SMILES | CS(=O)(=O)NC(=O)c1ccc(-c2ccc(CCNC[C@@H](O)c3ccccc3)cc2)cc1OCC(F)(F)F |
| InChI | InChI=1S/C26H27F3N2O5S/c1-37(34,35)31-25(33)22-12-11-21(15-24(22)36-17-26(27,28)29)19-9-7-18(8-10-19)13-14-30-16-23(32)20-5-3-2-4-6-20/h2-12,15,23,30,32H,13-14,16-17H2,1H3,(H,31,33)/t23-/m1/s1 |
| InChIKey | IFLLZMJDOIOBSH-HSZRJFAPSA-N |
| XLogP | 3.85 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|