C28H33FN2O5S — CID 69104477
2-(3-fluoropropoxy)-4-[4-[2-[[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide (PubChem CID 69104477) has the molecular formula C28H33FN2O5S and a molecular weight of 528.65 g/mol. Its IUPAC name is 2-(3-fluoropropoxy)-4-[4-[2-[[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide.
| Compound Name | 2-(3-fluoropropoxy)-4-[4-[2-[[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 69104477 |
| Molecular Formula | C28H33FN2O5S |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 2-(3-fluoropropoxy)-4-[4-[2-[[(1S,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]ethyl]phenyl]-N-methylsulfonylbenzamide |
| SMILES | C[C@H](NCCc1ccc(-c2ccc(C(=O)NS(C)(=O)=O)c(OCCCF)c2)cc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C28H33FN2O5S/c1-20(27(32)23-7-4-3-5-8-23)30-17-15-21-9-11-22(12-10-21)24-13-14-25(28(33)31-37(2,34)35)26(19-24)36-18-6-16-29/h3-5,7-14,19-20,27,30,32H,6,15-18H2,1-2H3,(H,31,33)/t20-,27+/m0/s1 |
| InChIKey | YSDQFUPBPPTHBM-CCLHPLFOSA-N |
| XLogP | 4.04 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|