C27H32ClNO5 — CID 69104166
4-[4-[2-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]ethoxy]phenyl]-2-propan-2-yloxybenzoic acid;hydrochloride (PubChem CID 69104166) has the molecular formula C27H32ClNO5 and a molecular weight of 486.01 g/mol. Its IUPAC name is 4-[4-[2-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]ethoxy]phenyl]-2-propan-2-yloxybenzoic acid;hydrochloride.
| Compound Name | 4-[4-[2-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]ethoxy]phenyl]-2-propan-2-yloxybenzoic acid;hydrochloride |
|---|---|
| PubChem CID | 69104166 |
| Molecular Formula | C27H32ClNO5 |
| Molecular Weight | 486.01 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 4-[4-[2-[[(1R,2S)-1-hydroxy-1-phenylpropan-2-yl]amino]ethoxy]phenyl]-2-propan-2-yloxybenzoic acid;hydrochloride |
| SMILES | CC(C)Oc1cc(-c2ccc(OCCN[C@@H](C)[C@H](O)c3ccccc3)cc2)ccc1C(=O)O.Cl |
| InChI | InChI=1S/C27H31NO5.ClH/c1-18(2)33-25-17-22(11-14-24(25)27(30)31)20-9-12-23(13-10-20)32-16-15-28-19(3)26(29)21-7-5-4-6-8-21;/h4-14,17-19,26,28-29H,15-16H2,1-3H3,(H,30,31);1H/t19-,26-;/m0./s1 |
| InChIKey | PVRUOBPVTKEMHG-GYUFFBBGSA-N |
| XLogP | 5.35 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.01 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|