C31H31NO6 — CID 10346356
4-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethoxy]-3-methylphenyl]-2-phenoxybenzoic acid (PubChem CID 10346356) has the molecular formula C31H31NO6 and a molecular weight of 513.59 g/mol. Its IUPAC name is 4-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethoxy]-3-methylphenyl]-2-phenoxybenzoic acid.
| Compound Name | 4-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethoxy]-3-methylphenyl]-2-phenoxybenzoic acid |
|---|---|
| PubChem CID | 10346356 |
| Molecular Formula | C31H31NO6 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | 4-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethoxy]-3-methylphenyl]-2-phenoxybenzoic acid |
| SMILES | Cc1cc(-c2ccc(C(=O)O)c(Oc3ccccc3)c2)ccc1OCCN[C@@H](C)[C@H](O)c1ccc(O)cc1 |
| InChI | InChI=1S/C31H31NO6/c1-20-18-23(24-10-14-27(31(35)36)29(19-24)38-26-6-4-3-5-7-26)11-15-28(20)37-17-16-32-21(2)30(34)22-8-12-25(33)13-9-22/h3-15,18-19,21,30,32-34H,16-17H2,1-2H3,(H,35,36)/t21-,30-/m0/s1 |
| InChIKey | YBYIDFYQJPJLBM-JRPXNJEYSA-N |
| XLogP | 5.95 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|