2-phenoxy-4-phenylbenzoic acid

C19H14O3 — CID 139966972

IUPAC2-phenoxy-4-phenylbenzoic acid
SMILESO=C(O)c1ccc(-c2ccccc2)cc1Oc1ccccc1
InChIInChI=1S/C19H14O3/c20-19(21)17-12-11-15(14-7-3-1-4-8-14)13-18(17)22-16-9-5-2-6-10-16/h1-13H,(H,20,21)
InChIKeySAZBSEMNEYECBK-UHFFFAOYSA-N
MW290.32 g/mol
LogP4.84
Rot. Bonds4

About 2-phenoxy-4-phenylbenzoic acid

2-phenoxy-4-phenylbenzoic acid (PubChem CID 139966972) has the molecular formula C19H14O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-phenoxy-4-phenylbenzoic acid.

Molecular Properties

Compound Name2-phenoxy-4-phenylbenzoic acid
PubChem CID139966972
Molecular FormulaC19H14O3
Molecular Weight290.32 g/mol
Exact Mass290.09
IUPAC Name2-phenoxy-4-phenylbenzoic acid
SMILESO=C(O)c1ccc(-c2ccccc2)cc1Oc1ccccc1
InChIInChI=1S/C19H14O3/c20-19(21)17-12-11-15(14-7-3-1-4-8-14)13-18(17)22-16-9-5-2-6-10-16/h1-13H,(H,20,21)
InChIKeySAZBSEMNEYECBK-UHFFFAOYSA-N
XLogP4.84
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.32
LogP ≤ 54.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-phenoxy-4-phenylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-[4-(2-iodoethoxy)-3-methylphenyl]-2-phenoxybenzoic acid
CID 147938385
2-(2-methylpropoxy)-4-phenylbenzoic acid
CID 162369990
5-(2-phenoxy-4-phenylphenyl)-2H-triazole-4-carboxylic acid
CID 174218489
2-(cyclopropylmethoxy)-4-phenylbenzoic acid
CID 162369991
benzoic acid;2-phenoxybenzoic acid
CID 160712085
2-chloro-4-phenylbenzoic acid
CID 21487426
2-phenoxybenzoic acid;propan-2-ol
CID 159883753
2-[(2-hydroxy-5-phenoxybenzoyl)amino]-4-phenylbenzoic acid
CID 58508485
1-N,4-N-dihydroxy-2,5-diphenoxybenzene-1,4-dicarboxamide
CID 167363578
1,2-bis(4-phenylphenoxy)benzene
CID 23083743
4-(3-aminophenyl)-2-methoxybenzoic acid
CID 53224921
2-phenoxy-N-(4-phenylphenyl)benzamide
CID 7926007

Frequently Asked Questions

What is the IUPAC name of 2-phenoxy-4-phenylbenzoic acid?
The IUPAC name of 2-phenoxy-4-phenylbenzoic acid (CID 139966972) is 2-phenoxy-4-phenylbenzoic acid.
What is the SMILES notation for 2-phenoxy-4-phenylbenzoic acid?
The canonical SMILES for 2-phenoxy-4-phenylbenzoic acid is O=C(O)c1ccc(-c2ccccc2)cc1Oc1ccccc1.
What is the InChIKey of 2-phenoxy-4-phenylbenzoic acid?
The InChIKey is SAZBSEMNEYECBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O3/c20-19(21)17-12-11-15(14-7-3-1-4-8-14)13-18(17)22-16-9-5-2-6-10-16/h1-13H,(H,20,21).
What are the key properties of 2-phenoxy-4-phenylbenzoic acid?
2-phenoxy-4-phenylbenzoic acid has a molecular weight of 290.32 g/mol, XLogP of 4.84, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenoxy-4-phenylbenzoic acid is sourced from PubChem (CID 139966972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).