About benzoic acid;2-phenoxybenzoic acid
benzoic acid;2-phenoxybenzoic acid (PubChem CID 160712085) has the molecular formula C20H16O5
and a molecular weight of 336.34 g/mol. Its IUPAC name is benzoic acid;2-phenoxybenzoic acid.
Molecular Properties
| Compound Name | benzoic acid;2-phenoxybenzoic acid |
| PubChem CID | 160712085 |
| Molecular Formula | C20H16O5 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | benzoic acid;2-phenoxybenzoic acid |
| SMILES | O=C(O)c1ccccc1.O=C(O)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C13H10O3.C7H6O2/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10;8-7(9)6-4-2-1-3-5-6/h1-9H,(H,14,15);1-5H,(H,8,9) |
| InChIKey | RRZMCVMGLJOVAY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzoic acid;2-phenoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;2-phenoxybenzoic acid?
The IUPAC name of benzoic acid;2-phenoxybenzoic acid (CID 160712085) is benzoic acid;2-phenoxybenzoic acid.
What is the SMILES notation for benzoic acid;2-phenoxybenzoic acid?
The canonical SMILES for benzoic acid;2-phenoxybenzoic acid is O=C(O)c1ccccc1.O=C(O)c1ccccc1Oc1ccccc1.
What is the InChIKey of benzoic acid;2-phenoxybenzoic acid?
The InChIKey is RRZMCVMGLJOVAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O3.C7H6O2/c14-13(15)11-8-4-5-9-12(11)16-10-6-2-1-3-7-10;8-7(9)6-4-2-1-3-5-6/h1-9H,(H,14,15);1-5H,(H,8,9).
What are the key properties of benzoic acid;2-phenoxybenzoic acid?
benzoic acid;2-phenoxybenzoic acid has a molecular weight of 336.34 g/mol, XLogP of 4.56, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;2-phenoxybenzoic acid is sourced from PubChem (CID 160712085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).