About phenyl 2-phenoxybenzoate
phenyl 2-phenoxybenzoate (PubChem CID 2471273) has the molecular formula C19H14O3
and a molecular weight of 290.32 g/mol. Its IUPAC name is phenyl 2-phenoxybenzoate.
Molecular Properties
| Compound Name | phenyl 2-phenoxybenzoate |
| PubChem CID | 2471273 |
| Molecular Formula | C19H14O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | phenyl 2-phenoxybenzoate |
| SMILES | O=C(Oc1ccccc1)c1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C19H14O3/c20-19(22-16-11-5-2-6-12-16)17-13-7-8-14-18(17)21-15-9-3-1-4-10-15/h1-14H |
| InChIKey | KDIILCSPFULFPX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-phenoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-phenoxybenzoate?
The IUPAC name of phenyl 2-phenoxybenzoate (CID 2471273) is phenyl 2-phenoxybenzoate.
What is the SMILES notation for phenyl 2-phenoxybenzoate?
The canonical SMILES for phenyl 2-phenoxybenzoate is O=C(Oc1ccccc1)c1ccccc1Oc1ccccc1.
What is the InChIKey of phenyl 2-phenoxybenzoate?
The InChIKey is KDIILCSPFULFPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O3/c20-19(22-16-11-5-2-6-12-16)17-13-7-8-14-18(17)21-15-9-3-1-4-10-15/h1-14H.
What are the key properties of phenyl 2-phenoxybenzoate?
phenyl 2-phenoxybenzoate has a molecular weight of 290.32 g/mol, XLogP of 4.70, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-phenoxybenzoate is sourced from PubChem (CID 2471273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).